2-methoxy-5-methylpyridin-3-ol
Catalog No: FT-0731419
CAS No: 1227574-65-3
- Chemical Name: 2-methoxy-5-methylpyridin-3-ol
- Molecular Formula: C7H9NO2
- Molecular Weight: 139.15
- InChI Key: JRDKEJRENRFMIP-UHFFFAOYSA-N
- InChI: InChI=1S/C7H9NO2/c1-5-3-6(9)7(10-2)8-4-5/h3-4,9H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 1227574-65-3 |
|---|---|
| MF: | C7H9NO2 |
| Density: | N/A |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | 2-Methoxy-5-methylpyridin-3-ol |
| Symbol: | GHS07 |
| Bolling_Point: | N/A |
| FW: | 139.15200 |
| Exact_Mass: | 139.06300 |
|---|---|
| MF: | C7H9NO2 |
| LogP: | 1.10420 |
| PSA: | 42.35000 |
| FW: | 139.15200 |
| Safety_Statements: | H302-H319 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P301 + P312 + P330-P305 + P351 + P338 |
| HS_Code: | 2933399090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)